JJEEPrep.app

JEE Main 2025 Jan 23 Shift 1 — Question Paper

64 questions

Mathematics

Q1JEE Main 2025 Jan 23 Shift 1Sets, Relations and FunctionsMedium

Let f(x)=logexf(x) = \log_e x and g(x)=x42x3+3x22x+22x22x+1g(x) = \frac{x^4 - 2x^3 + 3x^2 - 2x + 2}{2x^2 - 2x + 1}. Then the domain of fogfog is

  1. A

    R\mathbb{R}

  2. B

    [0,)[0, \infty)

  3. C

    (0,)(0, \infty)

  4. D

    [1,)[1, \infty)

Show answer

Correct option: A

Q2JEE Main 2025 Jan 23 Shift 1Sets, Relations and FunctionsMedium

Let R={(1,2),(2,3),(3,3)}R = \{(1, 2), (2, 3), (3, 3)\} be a relation defined on the set {1,2,3,4}\{1, 2, 3, 4\}. Then the minimum number of elements, needed to be added in RR so that RR becomes an equivalence relation, is:

  1. A

    77

  2. B

    88

  3. C

    99

  4. D

    1010

Show answer

Correct option: A

Q3JEE Main 2025 Jan 23 Shift 1Complex NumbersMedium

Let zˉi2zˉ+i=13\left|\frac{\bar{z} - i}{2\bar{z} + i}\right| = \frac{1}{3}, zCz \in \mathbb{C}, be the equation of a circle with center at CC. If the area of the triangle, whose vertices are at the points (0,0)(0, 0), CC and (α,0)(\alpha, 0) is 11 square units, then α2\alpha^2 equals:

  1. A

    5050

  2. B

    100100

  3. C

    8125\frac{81}{25}

  4. D

    12125\frac{121}{25}

Show answer

Correct option: B

Q4JEE Main 2025 Jan 23 Shift 1Matrices and DeterminantsMedium

If the system of equations

(λ1)x+(λ4)y+λz=5(\lambda - 1)x + (\lambda - 4)y + \lambda z = 5

λx+(λ1)y+(λ4)z=7\lambda x + (\lambda - 1)y + (\lambda - 4)z = 7

(λ+1)x+(λ+2)y(λ+2)z=9(\lambda + 1)x + (\lambda + 2)y - (\lambda + 2)z = 9

has infinitely many solutions, then λ2+λ\lambda^2 + \lambda is equal to

  1. A

    66

  2. B

    1010

  3. C

    2020

  4. D

    1212

Show answer

Correct option: D

Q5JEE Main 2025 Jan 23 Shift 1Matrices and DeterminantsMedium

If AA, BB, and (adj(A1)+adj(B1))(\mathrm{adj}(A^{-1}) + \mathrm{adj}(B^{-1})) are non-singular matrices of same order, then the inverse of A(adj(A1)+adj(B1))1BA(\mathrm{adj}(A^{-1}) + \mathrm{adj}(B^{-1}))^{-1}B, is equal to

  1. A

    AB1+A1BAB^{-1} + A^{-1}B

  2. B

    adj(B1)+adj(A1)\mathrm{adj}(B^{-1}) + \mathrm{adj}(A^{-1})

  3. C

    1AB(adj(B)+adj(A))\frac{1}{|AB|}(\mathrm{adj}(B) + \mathrm{adj}(A))

  4. D

    AB1A+BA1B\frac{AB^{-1}}{|A|} + \frac{BA^{-1}}{|B|}

Show answer

Correct option: C

Q6JEE Main 2025 Jan 23 Shift 1Sequences and SeriesMedium

If the first term of an A.P. is 3 and the sum of its first four terms is equal to one-fifth of the sum of the next four terms, then the sum of the first 20 terms is equal to

  1. A

    1080-1080

  2. B

    1020-1020

  3. C

    120-120

  4. D

    1200-1200

Show answer

Correct option: A

Q7JEE Main 2025 Jan 23 Shift 1Permutations and CombinationsEasy

The number of words, which can be formed using all the letters of the word “DAUGHTER”, so that all the vowels never come together, is

  1. A

    3400034000

  2. B

    3500035000

  3. C

    3600036000

  4. D

    3700037000

Show answer

Correct option: C

Q8JEE Main 2025 Jan 23 Shift 1ProbabilityMedium

One die has two faces marked 1, two faces marked 2, one face marked 3 and one face marked 4. Another die has one face marked 1, two faces marked 2, two faces marked 3 and one face marked 4. The probability of getting the sum of numbers to be 4 or 5, when both the dice are thrown together, is

  1. A

    23\frac{2}{3}

  2. B

    12\frac{1}{2}

  3. C

    49\frac{4}{9}

  4. D

    35\frac{3}{5}

Show answer

Correct option: B

Q9JEE Main 2025 Jan 23 Shift 1Straight LinesMedium

Let the area of a PQR\triangle PQR with vertices P(5,4)P(5, 4), Q(2,4)Q(-2, 4) and R(a,b)R(a, b) be 35 square units. If its orthocenter and centroid are O(2,145)O\left(2, \frac{14}{5}\right) and C(c,d)C(c, d) respectively, then c+2dc + 2d is equal to

  1. A

    22

  2. B

    73\frac{7}{3}

  3. C

    83\frac{8}{3}

  4. D

    33

Show answer

Correct option: D

Q10JEE Main 2025 Jan 23 Shift 1Inverse Trigonometric FunctionsMedium

If π2x3π4\frac{\pi}{2} \le x \le \frac{3\pi}{4}, then cos1(1213cosx+513sinx)\cos^{-1}\left(\frac{12}{13}\cos x + \frac{5}{13}\sin x\right) is equal to

  1. A

    xtan143x - \tan^{-1}\frac{4}{3}

  2. B

    x+tan145x + \tan^{-1}\frac{4}{5}

  3. C

    xtan1512x - \tan^{-1}\frac{5}{12}

  4. D

    x+tan1512x + \tan^{-1}\frac{5}{12}

Show answer

Correct option: C

Q11JEE Main 2025 Jan 23 Shift 1Trigonometric Ratios and EquationsMedium

The value of (sin70°)(cot10°cot70°1)(\sin 70°)(\cot 10° \cot 70° - 1) is

  1. A

    00

  2. B

    11

  3. C

    3/23/2

  4. D

    2/32/3

Show answer

Correct option: B

Q12JEE Main 2025 Jan 23 Shift 1Conic SectionsMedium

If the line 3x2y+12=03x - 2y + 12 = 0 intersects the parabola 4y=3x24y = 3x^2 at the points AA and BB, then at the vertex of the parabola, the line segment ABAB subtends an angle equal to

  1. A

    tan1(45)\tan^{-1}\left(\frac{4}{5}\right)

  2. B

    π2tan1(32)\frac{\pi}{2} - \tan^{-1}\left(\frac{3}{2}\right)

  3. C

    tan1(97)\tan^{-1}\left(\frac{9}{7}\right)

  4. D

    tan1(119)\tan^{-1}\left(\frac{11}{9}\right)

Show answer

Correct option: C

Q13JEE Main 2025 Jan 23 Shift 1Vector AlgebraMedium

Let the arc ACAC of a circle subtend a right angle at the centre OO. If the point BB on the arc ACAC, divides the arc ACAC such that length of arc ABlength of arc BC=15\frac{\text{length of arc } AB}{\text{length of arc } BC} = \frac{1}{5}, and OC=αOA+βOB\vec{OC} = \alpha \vec{OA} + \beta \vec{OB}, then α+2(31)β\alpha + \sqrt{2}(\sqrt{3} - 1)\beta is equal to

  1. A

    232\sqrt{3}

  2. B

    2+32 + \sqrt{3}

  3. C

    232 - \sqrt{3}

  4. D

    535\sqrt{3}

Show answer

Correct option: C

Q14JEE Main 2025 Jan 23 Shift 1Vector AlgebraHard

Let the position vectors of the vertices AA, BB and CC of a tetrahedron ABCDABCD be i^+2j^+k^\hat{i} + 2\hat{j} + \hat{k}, i^+3j^2k^\hat{i} + 3\hat{j} - 2\hat{k} and 2i^+j^k^2\hat{i} + \hat{j} - \hat{k} respectively. The altitude from the vertex DD to the opposite face ABCABC meets the median line segment through AA of the triangle ABCABC at the point EE. If the length of ADAD is 1103\frac{\sqrt{110}}{3} and the volume of the tetrahedron is 80562\frac{\sqrt{805}}{6\sqrt{2}}, then the position vector of EE is [Note: stem recovered from a low-resolution embedded thumbnail; the English and Hindi stem images were destroyed by PDF corruption — numeric values should be verified against another copy of this paper]

  1. A

    112(7i^+4j^+3k^)\frac{1}{12}(7\hat{i} + 4\hat{j} + 3\hat{k})

  2. B

    16(7i^+12j^+k^)\frac{1}{6}(7\hat{i} + 12\hat{j} + \hat{k})

  3. C

    16(12i^+12j^+k^)\frac{1}{6}(12\hat{i} + 12\hat{j} + \hat{k})

  4. D

    12(i^+4j^+7k^)\frac{1}{2}(\hat{i} + 4\hat{j} + 7\hat{k})

Show answer

Correct option: B

Q15JEE Main 2025 Jan 23 Shift 1Three Dimensional GeometryMedium

Let PP be the foot of the perpendicular from the point Q(10,3,1)Q(10, -3, -1) on the line x37=y21=z+12\frac{x-3}{7} = \frac{y-2}{-1} = \frac{z+1}{-2}. Then the area of the right angled triangle PQRPQR, where RR is the point (3,2,1)(3, -2, 1), is

  1. A

    30\sqrt{30}

  2. B

    8158\sqrt{15}

  3. C

    9159\sqrt{15}

  4. D

    3303\sqrt{30}

Show answer

Correct option: D

Q16JEE Main 2025 Jan 23 Shift 1Limits, Continuity and DifferentiabilityMedium

If the function

f(x)={2x{sin(k1+1)x+sin(k21)x},x<04,x=02xloge(2+k1x2+k2x),x>0f(x) = \begin{cases} \frac{2}{x}\{\sin(k_1 + 1)x + \sin(k_2 - 1)x\}, & x < 0 \\ 4, & x = 0 \\ \frac{2}{x}\log_e\left(\frac{2 + k_1 x}{2 + k_2 x}\right), & x > 0 \end{cases}

is continuous at x=0x = 0, then k12+k22k_1^2 + k_2^2 is equal to

  1. A

    55

  2. B

    88

  3. C

    1010

  4. D

    2020

Show answer

Correct option: C

Q17JEE Main 2025 Jan 23 Shift 1StatisticsMedium

The marks obtained by all the students of class 12 are presented in a frequency distribution with classes of equal width. Let the median class interval be 12-18 with median class frequency 12, and the median of these grouped data be 14. If the number of students whose marks are less than 12 is 18, then the total number of students is

  1. A

    4040

  2. B

    4444

  3. C

    4848

  4. D

    5252

Show answer

Correct option: B

Q18JEE Main 2025 Jan 23 Shift 1Integral CalculusMedium

Let I(x)=dx(x11)1113(x+15)1513I(x) = \int \frac{dx}{(x-11)^{\frac{11}{13}}(x+15)^{\frac{15}{13}}}. If I(37)I(24)=14(1b1131c113)I(37) - I(24) = \frac{1}{4}\left(\frac{1}{b^{\frac{1}{13}}} - \frac{1}{c^{\frac{1}{13}}}\right), b,cNb, c \in \mathbb{N}, then 3(b+c)3(b + c) is equal to

  1. A

    2222

  2. B

    2626

  3. C

    3939

  4. D

    4040

Show answer

Correct option: C

Q19JEE Main 2025 Jan 23 Shift 1Integral CalculusMedium

The value of

e2e41x(e((logex)2+1)1e((logex)2+1)1+e((6logex)2+1)1)dx\int_{e^2}^{e^4} \frac{1}{x}\left(\frac{e^{((\log_e x)^2 + 1)^{-1}}}{e^{((\log_e x)^2 + 1)^{-1}} + e^{((6 - \log_e x)^2 + 1)^{-1}}}\right) dx is

  1. A

    11

  2. B

    22

  3. C

    loge2\log_e 2

  4. D

    e2e^2

Show answer

Correct option: A

Q20JEE Main 2025 Jan 23 Shift 1Differential EquationsMedium

Let a curve y=f(x)y = f(x) pass through the points (0,5)(0, 5) and (loge2,k)(\log_e 2, k). If the curve satisfies the differential equation 2(3+y)e2xdx(7+e2x)dy=02(3 + y)e^{2x}dx - (7 + e^{2x})dy = 0, then kk is equal to

  1. A

    44

  2. B

    88

  3. C

    1616

  4. D

    3232

Show answer

Correct option: B

Q21JEE Main 2025 Jan 23 Shift 1Quadratic EquationsMediumNumerical

If the equation a(bc)x2+b(ca)x+c(ab)=0a(b - c)x^2 + b(c - a)x + c(a - b) = 0 has equal roots, where a+c=15a + c = 15 and b=365b = \frac{36}{5}, then a2+c2a^2 + c^2 is equal to____

Show answer

Answer: 117

Q22JEE Main 2025 Jan 23 Shift 1Integral CalculusMediumNumerical

If the area of the larger region bounded between the curves x2+y2=25x^2 + y^2 = 25 and y=x1y = |x - 1| is 14(bπ+c)\frac{1}{4}(b\pi + c), b,cNb, c \in \mathbb{N}, then b+cb + c is equal to ________.

Show answer

Answer: 77

Q23JEE Main 2025 Jan 23 Shift 1Binomial TheoremMediumNumerical

The sum of all rational terms in the expansion of (1+213+312)6(1 + 2^{\frac{1}{3}} + 3^{\frac{1}{2}})^6 is equal to ______

Show answer

Answer: 612

Physics

Q34JEE Main 2025 Jan 23 Shift 1OscillationsMedium

A light hollow cube of side length 10 cm and mass 10g, is floating in water. It is pushed down and released to execute simple harmonic oscillations. The time period of oscillations is yπ×102y\pi \times 10^{-2} s, where the value of yy is

(Acceleration due to gravity, g=10 m/s2g = 10\ \mathrm{m/s^2}, density of water =103 kg/m3= 10^3\ \mathrm{kg/m^3})

  1. A

    [Option lost due to PDF corruption]

  2. B

    [Option lost due to PDF corruption]

  3. C

    [Option lost due to PDF corruption]

  4. D

    [Option lost due to PDF corruption]

Show answer

Correct option: D

Q36JEE Main 2025 Jan 23 Shift 1ElectrostaticsHard

A point particle of charge QQ is placed at PP along the axis of an electric dipole 1 at a distance rr, as shown in the figure. The point PP is also at a distance rr from the equatorial plane of a second electric dipole 2. The dipoles are made of opposite charges qq separated by a distance 2a2a. For the charge particle at PP not to experience any net force, which of the following correctly describes the situation?

[Figure: dipole 1 (charges +q+q and q-q separated by 2a2a) lies along a horizontal axis with point P on this axis at distance rr from it; dipole 2 (charges +q+q and q-q separated by 2a2a) lies horizontally below P, with P at distance rr on its equatorial (perpendicular bisector) line]

  1. A

    ar0.5\frac{a}{r} \sim 0.5

  2. B

    ar20\frac{a}{r} \sim 20

  3. C

    ar3\frac{a}{r} \sim 3

  4. D

    ar10\frac{a}{r} \sim 10

Show answer

Correct option: C

Q37JEE Main 2025 Jan 23 Shift 1Electromagnetic Induction and Alternating CurrentsEasy

Regarding self-inductance:

A. The self-inductance of the coil depends on its geometry.

B. Self-inductance does not depend on the permeability of the medium.

C. Self-induced e.m.f. opposes any change in the current in a circuit.

D. Self-inductance is electromagnetic analogue of mass in mechanics.

E. Work needs to be done against self-induced e.m.f. in establishing the current.

Choose the correct answer from the options given below:

  1. A

    A, B, C, D only

  2. B

    B, C, D, E only

  3. C

    A, B, C, E only

  4. D

    A, C, D, E only

Show answer

Correct option: D

Q38JEE Main 2025 Jan 23 Shift 1Magnetic Effects of Current and MagnetismMedium

Consider a moving coil galvanomenter (MCG):

A. The torsional constant in moving coil galvanometer has dimentions [ML2T2][\mathrm{ML^2T^{-2}}]

B. Increasing the current sensitivity may not necessarily increase the voltage sensitivity.

C. If we increase number of turns (N) to its double (2N), then the voltage sensitivity doubles.

D. MCG can be converted into an ammeter by introducing a shunt resistance of large value in parallel with galvanometer.

E. Current sensitivity of MCG depends inversely on number of turns of coil.

Choose the correct answer from the options given below:

  1. A

    A, B, E Only

  2. B

    B, D, E Only

  3. C

    A, D Only

  4. D

    A, B Only

Show answer

Correct option: D

Q39JEE Main 2025 Jan 23 Shift 1Electromagnetic WavesMedium

The electric field of an electromagnetic wave in free space is E=57cos[7.5×106t5×103(3x+4y)](4i^3j^) N/C.\vec{E} = 57 \cos\left[7.5\times10^{6}\,\mathrm{t} - 5\times10^{-3}\left(3x+4y\right)\right]\left(4\hat{i}-3\hat{j}\right)\ \mathrm{N/C}. The associated magnetic field in Tesla is

  1. A

    B=573×108cos[7.5×106t5×103(3x+4y)](k^)\vec{B} = -\frac{57}{3\times10^{8}} \cos\left[7.5\times10^{6}\,\mathrm{t} - 5\times10^{-3}\left(3x+4y\right)\right]\left(\hat{k}\right)

  2. B

    B=573×108cos[7.5×106t5×103(3x+4y)](k^)\vec{B} = \frac{57}{3\times10^{8}} \cos\left[7.5\times10^{6}\,\mathrm{t} - 5\times10^{-3}\left(3x+4y\right)\right]\left(\hat{k}\right)

  3. C

    B=573×108cos[7.5×106t5×103(3x+4y)](5k^)\vec{B} = -\frac{57}{3\times10^{8}} \cos\left[7.5\times10^{6}\,\mathrm{t} - 5\times10^{-3}\left(3x+4y\right)\right]\left(5\hat{k}\right)

  4. D

    B=573×108cos[7.5×106t5×103(3x+4y)](5k^)\vec{B} = \frac{57}{3\times10^{8}} \cos\left[7.5\times10^{6}\,\mathrm{t} - 5\times10^{-3}\left(3x+4y\right)\right]\left(5\hat{k}\right)

Show answer

Correct option: C

Q40JEE Main 2025 Jan 23 Shift 1Ray OpticsHard

Given a thin convex lens (refractive index μ2\mu_2), kept in a liquid (refractive index μ1\mu_1, μ1<μ2\mu_1 < \mu_2) having radii of curvatures R1|R_1| and R2|R_2|. Its second surface is silver polished. Where should an object be placed on the optic axis so that a real and inverted image is formed at the same place?

  1. A

    (μ2+μ1)R1(μ2μ1)\frac{(\mu_2+\mu_1)|R_1|}{(\mu_2-\mu_1)}

  2. B

    μ1R1R2μ2(2R1+R2)μ1R1R2\frac{\mu_1|R_1|\cdot|R_2|}{\mu_2\left(2|R_1|+|R_2|\right)-\mu_1\sqrt{|R_1|\cdot|R_2|}}

  3. C

    μ1R1R2μ2(R1+R2)μ1R1\frac{\mu_1|R_1|\cdot|R_2|}{\mu_2\left(|R_1|+|R_2|\right)-\mu_1|R_1|}

  4. D

    μ1R1R2μ2(R1+R2)μ1R2\frac{\mu_1|R_1|\cdot|R_2|}{\mu_2\left(|R_1|+|R_2|\right)-\mu_1|R_2|}

Show answer

Correct option: D

Q41JEE Main 2025 Jan 23 Shift 1Ray OpticsEasy

What is the lateral shift of a ray refracted through a parallel-sided glass slab of thickness 'h' in terms of the angle of incidence 'i' and angle of refraction 'r', if the glass slab is placed in air medium?

  1. A

    hh

  2. B

    htan(ir)tanr\frac{h\tan(i-r)}{\tan r}

  3. C

    hcos(ir)sinr\frac{h\cos(i-r)}{\sin r}

  4. D

    hsin(ir)cosr\frac{h\sin(i-r)}{\cos r}

Show answer

Correct option: D

Q42JEE Main 2025 Jan 23 Shift 1Ray OpticsMedium

A spherical surface of radius of curvature R, separates air from glass (refractive index = 1.5). The centre of curvature is in the glass medium. A point object 'O' placed in air on the optic axis of the surface, so that its real image is formed at 'I' inside glass. The line OI intersects the spherical surface at P and PO = PI. The distance PO equals to

  1. A

    5R5\,R

  2. B

    3R3\,R

  3. C

    2R2\,R

  4. D

    1.5R1.5\,R

Show answer

Correct option: A

Q43JEE Main 2025 Jan 23 Shift 1Dual Nature of Matter and RadiationMedium

A sub-atomic particle of mass 103010^{-30} kg is moving with a velocity 2.21×1062.21 \times 10^{6} m/s. Under the matter wave consideration, the particle will behave closely like _____. (h=6.63×1034h = 6.63 \times 10^{-34} J.s)

  1. A

    Infra-red radiation

  2. B

    Visible radiation

  3. C

    X-rays

  4. D

    Gamma rays

Show answer

Correct option: C

Q44JEE Main 2025 Jan 23 Shift 1Atoms and NucleiMedium

The decay constant of a radioactive nucleus n2\mathrm{n_2} is 3 times that of another radioactive nucleus n1\mathrm{n_1}. If the initial number of both nuclei is the same, what is the ratio of the number of nuclei of n2\mathrm{n_2} to the number of nuclei of n1\mathrm{n_1} after one half-life of n1\mathrm{n_1}?

  1. A

    44

  2. B

    1/41/4

  3. C

    88

  4. D

    1/81/8

Show answer

Correct option: B

Q45JEE Main 2025 Jan 23 Shift 1Electronic DevicesMedium

Refer to the circuit diagram given in the figure. which of the following observations are correct?

A. Total resistance of circuit is 6 Ω\Omega

B. Current in Ammeter is 1A

C. Potential across AB is 4 Volts.

D. Potential across CD is 4 Volts

E. Total resistance of the circuit is 8 Ω\Omega.

Choose the correct answer from the options given below:

[Figure: circuit with battery E = 6 V in series with an ammeter leading to node C; a 4 Ω\Omega resistor from C down to node D; from D one branch has a 4 Ω\Omega resistor to the bottom rail and a second branch passes through a forward-biased diode to node A, then a 4 Ω\Omega resistor from A down to node B on the bottom rail]

  1. A

    A, B and C Only

  2. B

    A, C and D Only

  3. C

    B, C and E Only

  4. D

    A, B and D Only

Show answer

Correct option: D

Q46JEE Main 2025 Jan 23 Shift 1KinematicsMediumNumerical

Two particles are located at equal distance from origin. The position vectors of those are represented by A=2i^+3nj^+2k^\vec{A} = 2\hat{i} + 3n\hat{j} + 2\hat{k} and B=2i^2j^+4pk^\vec{B} = 2\hat{i} - 2\hat{j} + 4p\hat{k}, respectively. If both the vectors are at right angle to each other, the value of n1n^{-1} is _____.

Show answer

Answer: 3

Q47JEE Main 2025 Jan 23 Shift 1Work, Energy and PowerMediumNumerical

A force f=x2yi^+y2j^f = x^2y\hat{i} + y^2\hat{j} acts on a particle in a plane x+y=10x + y = 10. The work done by this force during a displacement from (0,0)(0, 0) to (4m,2m)(4\,\mathrm{m}, 2\,\mathrm{m}) is _____ Joule (round off to the nearest integer)

Show answer

Answer: 152

Q48JEE Main 2025 Jan 23 Shift 1ThermodynamicsMediumNumerical

An ideal gas, initially at 0C0\,^{\circ}\mathrm{C} temperature, is suddenly compressed to one quarter of its volume. If the ratio of specific heat at constant pressure to the specific heat at constant volume is 3/23/2, the change in temperature due to the thermodynamic process is _____ K.

Show answer

Answer: 273

Q49JEE Main 2025 Jan 23 Shift 1Electromagnetic Induction and Alternating CurrentsMediumNumerical

In the given circuit the sliding contact is pulled outwards such that electric current in the circuit changes at the rate of 8 A/s. At an instant when R is 12 Ω\Omega, the value of the current in the circuit will be _____ A.

[Figure: series circuit with a 12 V battery, a 3 H inductor, and a rheostat R (resistor with sliding contact)]

Show answer

Answer: 3

Q50JEE Main 2025 Jan 23 Shift 1ElectrostaticsMediumNumerical

A positive ion A and a negative ion B has charges 6.67×10196.67 \times 10^{-19} C and 9.6×10109.6 \times 10^{-10} C, and masses 19.2×102719.2 \times 10^{-27} kg and 9×10279 \times 10^{-27} kg respectively. At an instant, the ions are separated by a certain distance. At that instant the ratio of the magnitudes of electrostat_____

[Stem truncated: the remainder of this question is lost due to PDF corruption; the surviving text ends mid-sentence]

Chemistry

Q51JEE Main 2025 Jan 23 Shift 1Some Basic Concepts in ChemistryEasy

After removal of 102110^{21} molecules from 'xx' mg sample of CO2\mathrm{CO_2}, 2.8×1032.8 \times 10^{-3} mol of it are left. The mass of CO2\mathrm{CO_2} taken initially is :

Given : NA=6.02×1023 mol1\mathrm{N_A} = 6.02 \times 10^{23}\ \mathrm{mol^{-1}}

  1. A

    48.2 mg

  2. B

    98.3 mg

  3. C

    150.4 mg

  4. D

    196.2 mg

Show answer

Correct option: D

Q52JEE Main 2025 Jan 23 Shift 1Atomic StructureMedium

Heat treatment of muscular pain involves radiation of wavelength of about 900 nm. Which spectral line of H atom is suitable for this?

Given : Rydberg constant RH=105 cm1\mathrm{R_H} = 10^5\ \mathrm{cm^{-1}}, h=6.6×1034h = 6.6 \times 10^{-34} J s, c=3×108c = 3 \times 10^8 m/s)

  1. A

    Paschen series, 3\infty \rightarrow 3

  2. B

    Paschen series, 535 \rightarrow 3

  3. C

    Balmer series, 2\infty \rightarrow 2

  4. D

    Lyman series, 1\infty \rightarrow 1

Show answer

Correct option: A

Q53JEE Main 2025 Jan 23 Shift 1Chemical Bonding and Molecular StructureEasy

Match the LIST-I with LIST-II

LIST-I (Classification of molecules based on octet rule) LIST-II (Example)
A. Molecules obeying octet rule I. NO, NO2\mathrm{NO,\ NO_2}
B. Molecules with incomplete octet II. BCl3, AlCl3\mathrm{BCl_3,\ AlCl_3}
C. Molecules with incomplete octet with odd electron III. H2SO4, PCl5\mathrm{H_2SO_4,\ PCl_5}
D. Molecules with expanded octet IV. CCl4, CO2\mathrm{CCl_4,\ CO_2}

Choose the correct answer from the options given below:

  1. A

    A-II, B-IV, C-III, D-I

  2. B

    A-IV, B-I, C-III, D-II

  3. C

    A-III, B-II, C-I, D-IV

  4. D

    A-IV, B-II, C-I, D-III

Show answer

Correct option: D

Q54JEE Main 2025 Jan 23 Shift 1Chemical ThermodynamicsMedium

Ice at 5°C-5°\mathrm{C} is heated to become vapor with temperature of 110°C110°\mathrm{C} at atmospheric pressure. The entropy change associated with this process can be obtained from

  1. A

    268K383KCpdT+qrevT\int_{268\,\mathrm{K}}^{383\,\mathrm{K}} C_p\, \mathrm{d}T + \dfrac{q_{\text{rev}}}{T}

  2. B

    268K383KCpdT+ΔHmelting273+ΔHboiling373\int_{268\,\mathrm{K}}^{383\,\mathrm{K}} C_p\, \mathrm{d}T + \dfrac{\Delta H_{\text{melting}}}{273} + \dfrac{\Delta H_{\text{boiling}}}{373}

  3. C

    268K273KCp,mdT+ΔHm,fusionTf+ΔHm,vaporisationTb+273K373KCp,mdT+373K383KCp,mdT\int_{268\,\mathrm{K}}^{273\,\mathrm{K}} C_{p,\,m}\, \mathrm{d}T + \dfrac{\Delta H_{m,\,\text{fusion}}}{T_f} + \dfrac{\Delta H_{m,\,\text{vaporisation}}}{T_b} + \int_{273\,\mathrm{K}}^{373\,\mathrm{K}} C_{p,\,m}\, \mathrm{d}T + \int_{373\,\mathrm{K}}^{383\,\mathrm{K}} C_{p,\,m}\, \mathrm{d}T

  4. D

    268K273KCp,mTdT+ΔHm,fusionTf+ΔHm,vaporisationTb+273K373KCp,mTdT+373K383KCp,mTdT\int_{268\,\mathrm{K}}^{273\,\mathrm{K}} \dfrac{C_{p,\,m}}{T}\, \mathrm{d}T + \dfrac{\Delta H_{m,\,\text{fusion}}}{T_f} + \dfrac{\Delta H_{m,\,\text{vaporisation}}}{T_b} + \int_{273\,\mathrm{K}}^{373\,\mathrm{K}} \dfrac{C_{p,\,m}}{T}\, \mathrm{d}T + \int_{373\,\mathrm{K}}^{383\,\mathrm{K}} \dfrac{C_{p,\,m}}{T}\, \mathrm{d}T

Show answer

Correct option: D

Q55JEE Main 2025 Jan 23 Shift 1SolutionsMedium

CrCl3.xNH3\mathrm{CrCl_3.xNH_3} can exist as a complex. 0.1 molal aqueous solution of this complex shows a depression in freezing point of 0.558°C0.558°\mathrm{C}. Assuming 100% ionisation of this complex and coordination number of Cr is 6, the complex will be

(Given Kf=1.86\mathrm{K_f} = 1.86 K kg mol1^{-1})

  1. A

    [Cr(NH3)6]Cl3\mathrm{[Cr(NH_3)_6]\,Cl_3}

  2. B

    [Cr(NH3)5Cl]Cl2\mathrm{[Cr(NH_3)_5Cl]\,Cl_2}

  3. C

    [Cr(NH3)4Cl2]Cl\mathrm{[Cr(NH_3)_4Cl_2]\,Cl}

  4. D

    [Cr(NH3)3Cl3]\mathrm{[Cr(NH_3)_3Cl_3]}

Show answer

Correct option: B

Q56JEE Main 2025 Jan 23 Shift 1EquilibriumMedium

Which of the following happens when NH4OH\mathrm{NH_4OH} is added gradually to the solution containing 1M A2+\mathrm{A^{2+}} and 1M B3+\mathrm{B^{3+}} ions?

Given : Ksp[A(OH)2]=9×1010\mathrm{K_{sp}[A(OH)_2]} = 9 \times 10^{-10} and Ksp[B(OH)3]=27×1018\mathrm{K_{sp}[B(OH)_3]} = 27 \times 10^{-18} at 298 K.

  1. A

    B(OH)3\mathrm{B(OH)_3} will precipitate before A(OH)2\mathrm{A(OH)_2}

  2. B

    A(OH)2\mathrm{A(OH)_2} will precipitate before B(OH)3\mathrm{B(OH)_3}

  3. C

    A(OH)2\mathrm{A(OH)_2} and B(OH)3\mathrm{B(OH)_3} will precipitate together

  4. D

    Both A(OH)2\mathrm{A(OH)_2} and B(OH)3\mathrm{B(OH)_3} do not show precipitation with NH4OH\mathrm{NH_4OH}

Show answer

Correct option: A

Q57JEE Main 2025 Jan 23 Shift 1Redox Reactions and ElectrochemistryMedium

FeO42+2.0 VFe3+0.8 VFe2+0.5 VFe0\mathrm{FeO_4^{2-}} \xrightarrow{+2.0\ \mathrm{V}} \mathrm{Fe^{3+}} \xrightarrow{0.8\ \mathrm{V}} \mathrm{Fe^{2+}} \xrightarrow{-0.5\ \mathrm{V}} \mathrm{Fe^{0}}

In the above diagram, the standard electrode potentials are given in volts (over the arrow). The value of EFeO42/Fe2+E^{\ominus}_{\mathrm{FeO_4^{2-}}/\mathrm{Fe^{2+}}} is

  1. A

    1.2 V

  2. B

    1.7 V

  3. C

    1.4 V

  4. D

    2.1 V

Show answer

Correct option: B

Q58JEE Main 2025 Jan 23 Shift 1Classification of Elements and PeriodicityEasy

The element, which does not occur in the same period as the other elements (modern periodic table):

  1. A

    Osmium

  2. B

    Iridium

  3. C

    Palladium

  4. D

    Platinum

Show answer

Correct option: C

Q59JEE Main 2025 Jan 23 Shift 1p-Block ElementsMedium

The incorrect statement among the following is

  1. A

    PF3\mathrm{PF_3} exists but NF5\mathrm{NF_5} does not.

  2. B

    PH3\mathrm{PH_3} shows lower proton affinity than NH3\mathrm{NH_3}.

  3. C

    NO2\mathrm{NO_2} can dimerise easily.

  4. D

    SO2\mathrm{SO_2} can act as an oxidizing agent, but not as a reducing agent.

Show answer

Correct option: D

Q60JEE Main 2025 Jan 23 Shift 1d- and f-Block ElementsMedium

The correct set of ions (aqueous solution) with same colour from the following is:

  1. A

    Sc3+, Ti3+, Cr2+\mathrm{Sc^{3+},\ Ti^{3+},\ Cr^{2+}}

  2. B

    V2+, Cr3+, Mn3+\mathrm{V^{2+},\ Cr^{3+},\ Mn^{3+}}

  3. C

    Ti4+, V4+, Mn2+\mathrm{Ti^{4+},\ V^{4+},\ Mn^{2+}}

  4. D

    Zn2+, V3+, Fe3+\mathrm{Zn^{2+},\ V^{3+},\ Fe^{3+}}

Show answer

Correct option: B

Q61JEE Main 2025 Jan 23 Shift 1Coordination CompoundsMedium

The d– electronic configuration of an octahedral Co(II) complex having magnetic moment of 3.95 BM is:

  1. A

    t2g5eg2t_{2g}^{5}\, e_{g}^{2}

  2. B

    e4t23e^{4}\, t_{2}^{3}

  3. C

    t2g6eg1t_{2g}^{6}\, e_{g}^{1}

  4. D

    t2g3eg0t_{2g}^{3}\, e_{g}^{0}

Show answer

Correct option: A

Q62JEE Main 2025 Jan 23 Shift 1Coordination CompoundsEasy

The complex that shows Facial - Meridional isomerism is:

  1. A

    [Co(en)3]3+\mathrm{[Co(en)_3]^{3+}}

  2. B

    [Co(en)2Cl2]+\mathrm{[Co(en)_2Cl_2]^{+}}

  3. C

    [Co(NH3)3Cl3]\mathrm{[Co(NH_3)_3Cl_3]}

  4. D

    [Co(NH3)4Cl2]+\mathrm{[Co(NH_3)_4Cl_2]^{+}}

Show answer

Correct option: C

Q63JEE Main 2025 Jan 23 Shift 1Organic Compounds Containing HalogensHard

On chlorination under photochemical conditions, propane molecule gives two dichloro products "x" and "y". Among "x" and "y", "x" is an optically active molecule. How many trichloro products (consider structural isomers only) will be obtained from "x" when it is treated with chlorine again under photochemical conditions?

  1. A

    3

  2. B

    4

  3. C

    5

  4. D

    2

Show answer

Correct option: A

Q64JEE Main 2025 Jan 23 Shift 1Some Basic Principles of Organic ChemistryMedium

The correct stability order of the following species/molecules is:

[Figure: three ring structures — p: cyclopropenyl anion (three-membered ring with one C=C and a negative charge), q: cyclopentadienyl anion (five-membered ring with two C=C, an H and a negative charge on the sp³ carbon), r: cyclooctatetraene (eight-membered ring with four alternating C=C)]

  1. A

    p > q > r

  2. B

    r > q > p

  3. C

    q > r > p

  4. D

    q > p > r

Show answer

Correct option: C

Q65JEE Main 2025 Jan 23 Shift 1Organic Compounds Containing HalogensEasy

Match the LIST-I with LIST-II

LIST-I (Name reaction) LIST-II (Product obtainable)
A. Swarts reaction I. Ethyl benzene
B. Sandmeyer's reaction II. Ethyl iodide
C. Wurtz Fittig reaction III. Cyanobenzene
D. Finkelstein reaction IV. Ethyl fluoride

Choose the correct answer from the options given below:

  1. A

    A-II, B-III, C-I, D-IV

  2. B

    A-IV, B-I, C-III, D-II

  3. C

    A-IV, B-III, C-I, D-II

  4. D

    A-II, B-I, C-III, D-IV

Show answer

Correct option: C

Q66JEE Main 2025 Jan 23 Shift 1Organic Compounds Containing OxygenMedium

What amount of bromine will be required to convert 2 g of phenol into 2,4,6-tribromophenol?

(Given molar masses in g mol1^{-1} of C, H, O, Br are 12, 1, 16 and 80 respectively)

  1. A

    4.0 g

  2. B

    6.0 g

  3. C

    10.22 g

  4. D

    20.44 g

Show answer

Correct option: C

Q67JEE Main 2025 Jan 23 Shift 1Organic Compounds Containing OxygenMedium

The major product of the following reaction is:

CH3CH2CH=Orefluxexcess HCHOalkali?\mathrm{CH_3CH_2CH{=}O} \xrightarrow[\text{reflux}]{\substack{\text{excess HCHO} \\ \text{alkali}}} ?

  1. A

    CH3C(CH2OH)3\mathrm{CH_3{-}C(CH_2{-}OH)_3} (carbon bearing three CH2OH\mathrm{{-}CH_2{-}OH} groups)

  2. B

    CH3CH(CH2OH)CH=O\mathrm{CH_3{-}CH(CH_2{-}OH){-}CH{=}O}

  3. C

    CH3C(=CH2)CH=O\mathrm{CH_3{-}C({=}CH_2){-}CH{=}O}

  4. D

    CH3CH2CH2OH\mathrm{CH_3{-}CH_2{-}CH_2{-}OH}

Show answer

Correct option: A

Q68JEE Main 2025 Jan 23 Shift 1Organic Compounds Containing NitrogenMedium

Which among the following react with Hinsberg's reagent?

A. C6H5NH2\mathrm{C_6H_5{-}NH_2} (aniline)

B. C6H5N(CH3)2\mathrm{C_6H_5{-}N(CH_3)_2} (N,N-dimethylaniline)

C. CH3NH2\mathrm{CH_3{-}NH_2}

D. N(CH3)3\mathrm{N(CH_3)_3}

E. (C6H5)2NH\mathrm{(C_6H_5)_2NH} (diphenylamine)

Choose the correct answer from the options given below:

  1. A

    A, C and E Only

  2. B

    A, B and E Only

  3. C

    C and D Only

  4. D

    B and D Only

Show answer

Correct option: A

Q69JEE Main 2025 Jan 23 Shift 1BiomoleculesMedium

Given below are two statements:

Statement I: Fructose does not contain an aldehydic group but still reduces Tollen's reagent

Statement II: In the presence of base, fructose undergoes rearrangement to give glucose.

In the light of the above statements, choose the correct answer from the options given below

  1. A

    Both Statement I and Statement II are true

  2. B

    Both Statement I and Statement II are false

  3. C

    Statement I is true but Statement II is false

  4. D

    Statement I is false but Statement II is true

Show answer

Correct option: A

Q70JEE Main 2025 Jan 23 Shift 1Purification and Characterisation of Organic CompoundsMedium

Given below are two statements:

Statement I: In Lassaigne's test, the covalent organic molecules are transformed into ionic compounds.

Statement II: The sodium fusion extract of an organic compound having N and S gives prussian blue colour with FeSO4\mathrm{FeSO_4} and Na4[Fe(CN)6]\mathrm{Na_4[Fe(CN)_6]}

In the light of the above statements, choose the correct answer from the options given below

  1. A

    Both Statement I and Statement II are true

  2. B

    Both Statement I and Statement II are false

  3. C

    Statement I is true but Statement II is false

  4. D

    Statement I is false but Statement II is true

Show answer

Correct option: C

Q71JEE Main 2025 Jan 23 Shift 1Chemical ThermodynamicsEasyNumerical

The standard enthalpy and standard entropy of decomposition of N2O4\mathrm{N_2O_4} to NO2\mathrm{NO_2} are 55.0 kJ mol1^{-1} and 175.0 J/K/mol respectively. The standard free energy change for this reaction at 25°C in J mol1^{-1} is _____ (Nearest integer)

Show answer

Answer: 2850

Q72JEE Main 2025 Jan 23 Shift 1EquilibriumMediumNumerical

If 1 mM solution of ethylamine produces pH=9\mathrm{pH} = 9, then the ionization constant (Kb\mathrm{K_b}) of ethylamine is 10x10^{-x}. The value of x is _____ (nearest integer).

[The degree of ionization of ethylamine can be neglected with respect to unity.]

Show answer

Answer: 7

Q73JEE Main 2025 Jan 23 Shift 1Chemical KineticsHardNumerical

For the thermal decomposition reaction of N2O5(g)\mathrm{N_2O_5(g)} mentioned below, at constant volume, the following table can be created.

2N2O5(g)2N2O4(g)+O2(g)\mathrm{2N_2O_5(g) \rightarrow 2N_2O_4(g) + O_2(g)}

S.No. Time (s) Total pressure (atm)
1 0 0.6
2 100 'x'

x=x = _____ ×103\times 10^{-3} atm (nearest integer)

(Given : rate constant for the reaction is 4.606×102 s14.606 \times 10^{-2}\ \mathrm{s^{-1}}.)

Show answer

Answer: 897

Q74JEE Main 2025 Jan 23 Shift 1Organic Compounds Containing NitrogenMediumNumerical

Consider the following sequence of reactions to produce major product (A)

[Figure: 3-nitrotoluene (benzene ring with CH3\mathrm{CH_3} group and NO2\mathrm{NO_2} at the meta position)]

i) Br2, Feii) Sn,HCliii) NaNO2,HCl,273Kiv) H3PO2,H2O(A) Major Product\xrightarrow{\substack{\text{i) } \mathrm{Br_2},\ \mathrm{Fe} \\ \text{ii) } \mathrm{Sn}, \mathrm{HCl} \\ \text{iii) } \mathrm{NaNO_2}, \mathrm{HCl}, 273\,\mathrm{K} \\ \text{iv) } \mathrm{H_3PO_2}, \mathrm{H_2O}}} \text{(A) Major Product}

Molar mass of product (A) is _____ g mol1^{-1}.

(Given molar mass in g mol1^{-1} of C : 12, H: 1, O :16, Br : 80, N : 14, P :31)

Show answer

Answer: 171

Q75JEE Main 2025 Jan 23 Shift 1Purification and Characterisation of Organic CompoundsEasyNumerical

During "S" estimation, 160 mg of an organic compound gives 466 mg of barium sulphate. The percentage of Sulphur in the given compound is _____ %.

(Given molar mass in g mol1^{-1} of Ba : 137, S : 32, O : 16)

Show answer

Answer: 40