JJEEPrep.app

JEE Main 2025 Jan 23 Shift 2 — Question Paper

75 questions

Mathematics

Q1JEE Main 2025 Jan 23 Shift 2Sets, Relations and FunctionsMedium

Let A={(x,y)R×R:x+y3}A = \{(x, y) \in \mathbf{R} \times \mathbf{R} : |x+y| \geq 3\} and B={(x,y)R×R:x+y3}B = \{(x, y) \in \mathbf{R} \times \mathbf{R} : |x| + |y| \leq 3\}. If C={(x,y)AB:x=0 or y=0}C = \{(x, y) \in A \cap B : x = 0 \text{ or } y = 0\}, then (x,y)Cx+y\sum_{(x, y) \in C} |x+y| is :

  1. A

    2424

  2. B

    1818

  3. C

    1515

  4. D

    1212

Show answer

Correct option: D

Q2JEE Main 2025 Jan 23 Shift 2Sets, Relations and FunctionsMedium

Let X=R×RX = \mathbf{R} \times \mathbf{R}. Define a relation R on X as :

(a1,b1) R (a2,b2)b1=b2(a_1, b_1) \text{ R } (a_2, b_2) \Leftrightarrow b_1 = b_2.

Statement I : R is an equivalence relation.

Statement II : For some (a,b)X(a, b) \in X, the set S={(x,y)X:(x,y) R (a,b)}S = \{(x, y) \in X : (x, y) \text{ R } (a, b)\} represents a line parallel to y=xy = x.

In the light of the above statements, choose the correct answer from the options given below :

  1. A

    Both Statement I and Statement II are true

  2. B

    Both Statement I and Statement II are false

  3. C

    Statement I is true but Statement II is false

  4. D

    Statement I is false but Statement II is true

Show answer

Correct option: C

Q3JEE Main 2025 Jan 23 Shift 2Complex NumbersMedium

The number of complex numbers zz, satisfying z=1|z| = 1 and zzˉ+zˉz=1\left|\dfrac{z}{\bar{z}} + \dfrac{\bar{z}}{z}\right| = 1, is :

  1. A

    44

  2. B

    66

  3. C

    88

  4. D

    1010

Show answer

Correct option: C

Q4JEE Main 2025 Jan 23 Shift 2Matrices and DeterminantsMedium

The system of equations x+y+z=6,x + y + z = 6, x+2y+5z=9,x + 2y + 5z = 9, x+5y+λz=μ,x + 5y + \lambda z = \mu, has no solution if

  1. A

    λ=17, μ18\lambda = 17,\ \mu \neq 18

  2. B

    λ=15, μ17\lambda = 15,\ \mu \neq 17

  3. C

    λ17, μ18\lambda \neq 17,\ \mu \neq 18

  4. D

    λ=17, μ=18\lambda = 17,\ \mu = 18

Show answer

Correct option: A

Q5JEE Main 2025 Jan 23 Shift 2Matrices and DeterminantsMedium

Let A=[aij]A = [a_{ij}] be a 3×33 \times 3 matrix such that A[010]=[001]A \begin{bmatrix} 0 \\ 1 \\ 0 \end{bmatrix} = \begin{bmatrix} 0 \\ 0 \\ 1 \end{bmatrix}, A[413]=[010]A \begin{bmatrix} 4 \\ 1 \\ 3 \end{bmatrix} = \begin{bmatrix} 0 \\ 1 \\ 0 \end{bmatrix} and A[212]=[100]A \begin{bmatrix} 2 \\ 1 \\ 2 \end{bmatrix} = \begin{bmatrix} 1 \\ 0 \\ 0 \end{bmatrix}, then a23a_{23} equals :

  1. A

    00

  2. B

    11

  3. C

    1-1

  4. D

    22

Show answer

Correct option: C

Q6JEE Main 2025 Jan 23 Shift 2Binomial TheoremMedium

If in the expansion of (1+x)p(1x)q(1+x)^{\mathrm{p}} (1-x)^{\mathrm{q}}, the coefficients of xx and x2x^2 are 1 and 2-2, respectively, then p2+q2\mathrm{p}^2 + \mathrm{q}^2 is equal to :

  1. A

    88

  2. B

    1313

  3. C

    1818

  4. D

    2020

Show answer

Correct option: B

Q7JEE Main 2025 Jan 23 Shift 2ProbabilityMedium

A board has 16 squares as shown in the figure :

[Figure: a 4 × 4 grid of 16 squares]

Out of these 16 squares, two squares are chosen at random. The probability that they have no side in common is :

  1. A

    2330\dfrac{23}{30}

  2. B

    35\dfrac{3}{5}

  3. C

    710\dfrac{7}{10}

  4. D

    45\dfrac{4}{5}

Show answer

Correct option: D

Q8JEE Main 2025 Jan 23 Shift 2Straight LinesHard

A rod of length eight units moves such that its ends A and B always lie on the lines xy+2=0x - y + 2 = 0 and y+2=0y + 2 = 0, respectively. If the locus of the point P, that divides the rod AB internally in the ratio 2:12 : 1 is 9(x2+αy2+βxy+γx+28y)76=09(x^2 + \alpha y^2 + \beta xy + \gamma x + 28y) - 76 = 0, then αβγ\alpha - \beta - \gamma is equal to :

  1. A

    2121

  2. B

    2222

  3. C

    2323

  4. D

    2424

Show answer

Correct option: C

Q9JEE Main 2025 Jan 23 Shift 2Conic SectionsMedium

The length of the chord of the ellipse x24+y22=1\dfrac{x^2}{4} + \dfrac{y^2}{2} = 1, whose mid-point is (1,12)\left(1, \dfrac{1}{2}\right), is :

  1. A

    15\sqrt{15}

  2. B

    1315\dfrac{1}{3}\sqrt{15}

  3. C

    5315\dfrac{5}{3}\sqrt{15}

  4. D

    2315\dfrac{2}{3}\sqrt{15}

Show answer

Correct option: D

Q10JEE Main 2025 Jan 23 Shift 2Conic SectionsMedium

Let the shortest distance from (a,0)(a, 0), a>0a > 0, to the parabola y2=4xy^2 = 4x be 4. Then the equation of the circle passing through the point (a,0)(a, 0) and the focus of the parabola, and having its centre on the axis of the parabola is :

  1. A

    x2+y28x+7=0x^2 + y^2 - 8x + 7 = 0

  2. B

    x2+y210x+9=0x^2 + y^2 - 10x + 9 = 0

  3. C

    x2+y26x+5=0x^2 + y^2 - 6x + 5 = 0

  4. D

    x2+y24x+3=0x^2 + y^2 - 4x + 3 = 0

Show answer

Correct option: C

Q11JEE Main 2025 Jan 23 Shift 2Trigonometric Ratios and EquationsHard

Let the range of the function f(x)=6+16cosxcos(π3x)cos(π3+x)sin3xcos6xf(x) = 6 + 16\cos x \cdot \cos\left(\dfrac{\pi}{3} - x\right) \cdot \cos\left(\dfrac{\pi}{3} + x\right) \cdot \sin 3x \cdot \cos 6x, xRx \in \mathbf{R} be [α,β][\alpha, \beta]. Then the distance of the point (α,β)(\alpha, \beta) from the line 3x+4y+12=03x + 4y + 12 = 0 is :

  1. A

    88

  2. B

    99

  3. C

    1010

  4. D

    1111

Show answer

Correct option: D

Q12JEE Main 2025 Jan 23 Shift 2Three Dimensional GeometryMedium

The distance of the line x22=y63=z34\dfrac{x-2}{2} = \dfrac{y-6}{3} = \dfrac{z-3}{4} from the point (1,4,0)(1, 4, 0) along the line x1=y22=z+33\dfrac{x}{1} = \dfrac{y-2}{2} = \dfrac{z+3}{3} is :

  1. A

    14\sqrt{14}

  2. B

    15\sqrt{15}

  3. C

    13\sqrt{13}

  4. D

    17\sqrt{17}

Show answer

Correct option: A

Q13JEE Main 2025 Jan 23 Shift 2Three Dimensional GeometryMedium

If the square of the shortest distance between the lines x21=y12=z+33\dfrac{x-2}{1} = \dfrac{y-1}{2} = \dfrac{z+3}{-3} and x+12=y+34=z+55\dfrac{x+1}{2} = \dfrac{y+3}{4} = \dfrac{z+5}{-5} is mn\dfrac{\mathrm{m}}{\mathrm{n}}, where m, n are coprime numbers, then m+n\mathrm{m} + \mathrm{n} is equal to :

  1. A

    66

  2. B

    99

  3. C

    1414

  4. D

    2121

Show answer

Correct option: B

Q14JEE Main 2025 Jan 23 Shift 2Limits, Continuity and DifferentiabilityMedium

limx(2x23x+5)(3x1)x2(3x2+5x+4)(3x+2)x\lim\limits_{x \to \infty} \dfrac{(2x^2 - 3x + 5)(3x - 1)^{\frac{x}{2}}}{(3x^2 + 5x + 4)\sqrt{(3x + 2)^x}} is equal to :

  1. A

    2e3\dfrac{2\mathrm{e}}{3}

  2. B

    23e\dfrac{2}{3\sqrt{\mathrm{e}}}

  3. C

    23e\dfrac{2}{\sqrt{3\mathrm{e}}}

  4. D

    2e3\dfrac{2\mathrm{e}}{\sqrt{3}}

Show answer

Correct option: B

Q15JEE Main 2025 Jan 23 Shift 2Differentiation and Applications of DerivativesMedium

A spherical chocolate ball has a layer of ice-cream of uniform thickness around it. When the thickness of the ice-cream layer is 1 cm, the ice-cream melts at the rate of 81 cm3/min81\ \mathrm{cm}^3/\text{min} and the thickness of the ice-cream layer decreases at the rate of 14π\dfrac{1}{4\pi} cm/min. The surface area (in cm2\mathrm{cm}^2) of the chocolate ball (without the ice-cream layer) is :

  1. A

    196 π196\ \pi

  2. B

    128 π128\ \pi

  3. C

    256 π256\ \pi

  4. D

    225 π225\ \pi

Show answer

Correct option: C

Q16JEE Main 2025 Jan 23 Shift 2Integral CalculusMedium

If the area of the region {(x,y):1x1,0ya+exex,a>0}\{(x, y) : -1 \leq x \leq 1, 0 \leq y \leq \mathrm{a} + \mathrm{e}^{|x|} - \mathrm{e}^{-x}, \mathrm{a} > 0\} is e2+8e+1e\dfrac{\mathrm{e}^2 + 8\mathrm{e} + 1}{\mathrm{e}}, then the value of a is :

  1. A

    55

  2. B

    66

  3. C

    77

  4. D

    88

Show answer

Correct option: A

Q17JEE Main 2025 Jan 23 Shift 2Integral CalculusMedium

Let x3sinxdx=g(x)+C\int x^3 \sin x\, \mathrm{d}x = g(x) + C, where C is the constant of integration. If 8(g(π2)+g(π2))=απ3+βπ2+γ8\left(g\left(\dfrac{\pi}{2}\right) + g'\left(\dfrac{\pi}{2}\right)\right) = \alpha\pi^3 + \beta\pi^2 + \gamma, α,β,γZ\alpha, \beta, \gamma \in \mathbf{Z}, then α+βγ\alpha + \beta - \gamma equals :

  1. A

    5555

  2. B

    4848

  3. C

    4747

  4. D

    6262

Show answer

Correct option: A

Q18JEE Main 2025 Jan 23 Shift 2Integral CalculusHard

If I=0π2sin32xsin32x+cos32xdx\mathrm{I} = \displaystyle\int_0^{\frac{\pi}{2}} \dfrac{\sin^{\frac{3}{2}} x}{\sin^{\frac{3}{2}} x + \cos^{\frac{3}{2}} x}\, \mathrm{d}x, then 02Ixsinxcosxsin4x+cos4xdx\displaystyle\int_0^{2\mathrm{I}} \dfrac{x \sin x \cos x}{\sin^4 x + \cos^4 x}\, \mathrm{d}x equals :

  1. A

    π24\dfrac{\pi^2}{4}

  2. B

    π28\dfrac{\pi^2}{8}

  3. C

    π212\dfrac{\pi^2}{12}

  4. D

    π216\dfrac{\pi^2}{16}

Show answer

Correct option: D

Q19JEE Main 2025 Jan 23 Shift 2Differential EquationsHard

Let x=x(y)x = x(y) be the solution of the differential equation y=(xydxdy)sin(xy)y = \left(x - y \dfrac{\mathrm{d}x}{\mathrm{d}y}\right) \sin\left(\dfrac{x}{y}\right), y>0y > 0 and x(1)=π2x(1) = \dfrac{\pi}{2}. Then cos(x(2))\cos(x(2)) is equal to :

  1. A

    12(loge2)21 - 2(\log_{\mathrm{e}} 2)^2

  2. B

    2(loge2)212(\log_{\mathrm{e}} 2)^2 - 1

  3. C

    2(loge2)12(\log_{\mathrm{e}} 2) - 1

  4. D

    12(loge2)1 - 2(\log_{\mathrm{e}} 2)

Show answer

Correct option: B

Q20JEE Main 2025 Jan 23 Shift 2Vector AlgebraMedium

Let the point A divide the line segment joining the points P(1,1,2)P(-1, -1, 2) and Q(5,5,10)Q(5, 5, 10) internally in the ratio r:1r : 1 (r>0)(r > 0). If O is the origin and (OQOA)15OP×OA2=10\left(\overrightarrow{\mathrm{OQ}} \cdot \overrightarrow{\mathrm{OA}}\right) - \dfrac{1}{5}\left|\overrightarrow{\mathrm{OP}} \times \overrightarrow{\mathrm{OA}}\right|^2 = 10, then the value of rr is :

  1. A

    33

  2. B

    7\sqrt{7}

  3. C

    77

  4. D

    1414

Show answer

Correct option: C

Q21JEE Main 2025 Jan 23 Shift 2Sequences and SeriesMediumNumerical

The roots of the quadratic equation 3x2px+q=03x^2 - \mathrm{p}x + \mathrm{q} = 0 are 10th10^{\text{th}} and 11th11^{\text{th}} terms of an arithmetic progression with common difference 32\dfrac{3}{2}. If the sum of the first 11 terms of this arithmetic progression is 88, then q2p\mathrm{q} - 2\mathrm{p} is equal to _________.

Show answer

Answer: 474

Q22JEE Main 2025 Jan 23 Shift 2Quadratic EquationsHardNumerical

Let α,β\alpha, \beta be the roots of the equation x2axb=0x^2 - \mathrm{a}x - \mathrm{b} = 0 with Im(α)<Im(β)\text{Im}(\alpha) < \text{Im}(\beta). Let Pn=αnβn\mathrm{P_n} = \alpha^{\mathrm{n}} - \beta^{\mathrm{n}}. If P3=57i\mathrm{P_3} = -5\sqrt{7}\, i, P4=37i\mathrm{P_4} = -3\sqrt{7}\, i, P5=117i\mathrm{P_5} = 11\sqrt{7}\, i and P6=457i\mathrm{P_6} = 45\sqrt{7}\, i, then α4+β4|\alpha^4 + \beta^4| is equal to _________.

Show answer

Answer: 31

Q23JEE Main 2025 Jan 23 Shift 2Permutations and CombinationsMediumNumerical

The number of ways, 5 boys and 4 girls can sit in a row so that either all the boys sit together or no two boys sit together, is _________.

Show answer

Answer: 17280

Q24JEE Main 2025 Jan 23 Shift 2StatisticsMediumNumerical

The variance of the numbers 8,21,34,47,,3208, 21, 34, 47, \ldots, 320 is _________.

Show answer

Answer: 8788

Q25JEE Main 2025 Jan 23 Shift 2CirclesMediumNumerical

The focus of the parabola y2=4x+16y^2 = 4x + 16 is the centre of the circle C of radius 5. If the values of λ\lambda, for which C passes through the point of intersection of the lines 3xy=03x - y = 0 and x+λy=4x + \lambda y = 4, are λ1\lambda_1 and λ2\lambda_2, λ1<λ2\lambda_1 < \lambda_2, then 12λ1+29λ212\lambda_1 + 29\lambda_2 is equal to _________.

Show answer

Answer: 15

Physics

Q26JEE Main 2025 Jan 23 Shift 2Units and MeasurementsEasy

Match List - I with List - II.

List - I List - II
(A) Permeability of free space (I) [ML2T2][\mathrm{M\,L^2\,T^{-2}}]
(B) Magnetic field (II) [MT2A1][\mathrm{M\,T^{-2}\,A^{-1}}]
(C) Magnetic moment (III) [MLT2A2][\mathrm{M\,L\,T^{-2}\,A^{-2}}]
(D) Torsion constant (IV) [L2A][\mathrm{L^2\,A}]

Choose the correct answer from the options given below :

  1. A

    (A)-(III), (B)-(II), (C)-(IV), (D)-(I)

  2. B

    (A)-(IV), (B)-(III), (C)-(I), (D)-(II)

  3. C

    (A)-(I), (B)-(IV), (C)-(II), (D)-(III)

  4. D

    (A)-(II), (B)-(I), (C)-(III), (D)-(IV)

Show answer

Correct option: A

Q27JEE Main 2025 Jan 23 Shift 2Units and MeasurementsMedium

The energy of a system is given as E(t)=α3eβtE(t) = \alpha^3 e^{-\beta t}, where tt is the time and β=0.3 s1\beta = 0.3~\mathrm{s^{-1}}. The errors in the measurement of α\alpha and tt are 1.2%1.2\% and 1.6%1.6\%, respectively. At t=5t = 5 s, maximum percentage error in the energy is :

  1. A

    6%6\%

  2. B

    4%4\%

  3. C

    11.6%11.6\%

  4. D

    8.4%8.4\%

Show answer

Correct option: A

Q28JEE Main 2025 Jan 23 Shift 2Work, Energy and PowerEasy

A ball having kinetic energy KE, is projected at an angle of 60°60° from the horizontal. What will be the kinetic energy of ball at the highest point of its flight ?

  1. A

    (KE)2\frac{(\mathrm{KE})}{2}

  2. B

    (KE)8\frac{(\mathrm{KE})}{8}

  3. C

    (KE)16\frac{(\mathrm{KE})}{16}

  4. D

    (KE)4\frac{(\mathrm{KE})}{4}

Show answer

Correct option: D

Q29JEE Main 2025 Jan 23 Shift 2Rotational MotionMedium

A circular disk of radius R meter and mass M kg is rotating around the axis perpendicular to the disk. An external torque is applied to the disk such that θ(t)=5t28t\theta(t) = 5t^2 - 8t, where θ(t)\theta(t) is the angular position of the rotating disc as a function of time t.

How much power is delivered by the applied torque, when t=2t = 2 s ?

  1. A

    8 MR28~\mathrm{MR^2}

  2. B

    60 MR260~\mathrm{MR^2}

  3. C

    72 MR272~\mathrm{MR^2}

  4. D

    108 MR2108~\mathrm{MR^2}

Show answer

Correct option: B

Q30JEE Main 2025 Jan 23 Shift 2GravitationMedium

If a satellite orbiting the Earth is 9 times closer to the Earth than the Moon, what is the time period of rotation of the satellite? Given rotational time period of Moon =27= 27 days and gravitational attraction between the satellite and the moon is neglected.

  1. A

    27 days

  2. B

    3 days

  3. C

    81 days

  4. D

    1 day

Show answer

Correct option: D

Q31JEE Main 2025 Jan 23 Shift 2Properties of Solids and LiquidsMedium

A massless spring gets elongated by amount x1x_1 under a tension of 5 N. Its elongation is x2x_2 under the tension of 7 N. For the elongation of (5x12x2)(5x_1 - 2x_2), the tension in the spring will be :

  1. A

    39 N

  2. B

    11 N

  3. C

    15 N

  4. D

    20 N

Show answer

Correct option: B

Q32JEE Main 2025 Jan 23 Shift 2Properties of Solids and LiquidsMedium

Water flows in a horizontal pipe whose one end is closed with a valve. The reading of the pressure gauge attached to the pipe is P1P_1. The reading of the pressure gauge falls to P2P_2 when the valve is opened. The speed of water flowing in the pipe is proportional to

  1. A

    P1P2P_1 - P_2

  2. B

    P1P2\sqrt{P_1 - P_2}

  3. C

    (P1P2)2(P_1 - P_2)^2

  4. D

    (P1P2)4(P_1 - P_2)^4

Show answer

Correct option: B

Q33JEE Main 2025 Jan 23 Shift 2ThermodynamicsEasy

[Figure: P-V diagram with points A (2V0,P0)(2V_0, P_0), B (3V0,P0)(3V_0, P_0), C (3V0,2P0)(3V_0, 2P_0) and D (V0,2P0)(V_0, 2P_0); the path goes A → B (horizontal at P0P_0), B → C (vertical at 3V03V_0), C → D (horizontal at 2P02P_0)]

Using the given P-V diagram, the work done by an ideal gas along the path ABCD is :

  1. A

    4 P0V04~P_0V_0

  2. B

    4 P0V0-4~P_0V_0

  3. C

    3 P0V03~P_0V_0

  4. D

    3 P0V0-3~P_0V_0

Show answer

Correct option: D

Q34JEE Main 2025 Jan 23 Shift 2ThermodynamicsMedium

Water of mass m gram is slowly heated to increase the temperature from T1T_1 to T2T_2. The change in entropy of the water, given specific heat of water is 1 Jkg1K11~\mathrm{J\,kg^{-1}\,K^{-1}}, is :

  1. A

    mln(T2T1)m\,ln\left(\frac{T_2}{T_1}\right)

  2. B

    mln(T1T2)m\,ln\left(\frac{T_1}{T_2}\right)

  3. C

    m(T2T1)m(T_2 - T_1)

  4. D

    zero

Show answer

Correct option: A

Q35JEE Main 2025 Jan 23 Shift 2WavesMedium

The equation of a transverse wave travelling along a string is y(x,t)=4.0sin[20×103x+600t]y(x, t) = 4.0 \sin\left[20 \times 10^{-3} x + 600 t\right] mm, where xx is in mm and tt is in second. The velocity of the wave is :

  1. A

    60-60 m/s

  2. B

    30-30 m/s

  3. C

    +30+30 m/s

  4. D

    +60+60 m/s

Show answer

Correct option: B

Q36JEE Main 2025 Jan 23 Shift 2ElectrostaticsMedium

Two point charges 4 μc-4~\mu c and 4 μc4~\mu c, constituting an electric dipole, are placed at (9,0,0)(-9, 0, 0) cm and (9,0,0)(9, 0, 0) cm in a uniform electric field of strength 104 NC110^4~\mathrm{NC^{-1}}. The work done on the dipole in rotating it from the equilibrium through 180°180° is :

  1. A

    12.4 mJ

  2. B

    14.4 mJ

  3. C

    16.4 mJ

  4. D

    18.4 mJ

Show answer

Correct option: B

Q37JEE Main 2025 Jan 23 Shift 2Magnetic Effects of Current and MagnetismMedium

A galvanometer having a coil of resistance 30 Ω30~\Omega need 20 mA of current for full-scale deflection. If a maximum current of 3 A is to be measured using this galvanometer, the resistance of the shunt to be added to the galvanometer should be 30X Ω\frac{30}{X}~\Omega, where X is

  1. A

    149

  2. B

    298

  3. C

    447

  4. D

    596

Show answer

Correct option: A

Q38JEE Main 2025 Jan 23 Shift 2ElectrostaticsMedium

Two charges 7 μc7~\mu c and 4 μc-4~\mu c are placed at (7 cm,0,0)(-7~\mathrm{cm}, 0, 0) and (7 cm,0,0)(7~\mathrm{cm}, 0, 0) respectively. Given, ϵ0=8.85×1012 C2N1m2\epsilon_0 = 8.85 \times 10^{-12}~\mathrm{C^2\,N^{-1}\,m^{-2}}, the electrostatic potential energy of the charge configuration is :

  1. A

    1.2-1.2 J

  2. B

    1.5-1.5 J

  3. C

    1.8-1.8 J

  4. D

    2.0-2.0 J

Show answer

Correct option: C

Q39JEE Main 2025 Jan 23 Shift 2Electromagnetic WavesEasy

A plane electromagnetic wave of frequency 20 MHz travels in free space along the +x+x direction. At a particular point in space and time, the electric field vector of the wave is Ey=9.3 Vm1E_y = 9.3~\mathrm{Vm^{-1}}. Then, the magnetic field vector of the wave at that point is

  1. A

    Bz=6.2×108B_z = 6.2 \times 10^{-8} T

  2. B

    Bz=9.3×108B_z = 9.3 \times 10^{-8} T

  3. C

    Bz=3.1×108B_z = 3.1 \times 10^{-8} T

  4. D

    Bz=1.55×108B_z = 1.55 \times 10^{-8} T

Show answer

Correct option: C

Q40JEE Main 2025 Jan 23 Shift 2Ray OpticsEasy

The refractive index of the material of a glass prism is 3\sqrt{3}. The angle of minimum deviation is equal to the angle of the prism. What is the angle of the prism ?

  1. A

    50°50°

  2. B

    58°58°

  3. C

    60°60°

  4. D

    48°48°

Show answer

Correct option: C

Q41JEE Main 2025 Jan 23 Shift 2Wave OpticsMedium

The width of one of the two slits in Young's double slit experiment is dd while that of the other slit is xdxd. If the ratio of the maximum to the minimum intensity in the interference pattern on the screen is 9:49 : 4 then what is the value of xx ?

(Assume that the field strength varies according to the slit width.)

  1. A

    4

  2. B

    5

  3. C

    3

  4. D

    2

Show answer

Correct option: B

Q42JEE Main 2025 Jan 23 Shift 2Ray OpticsEasy

A concave mirror of focal length ff in air is dipped in a liquid of refractive index μ\mu. Its focal length in the liquid will be :

  1. A

    fμ\frac{f}{\mu}

  2. B

    μf\mu f

  3. C

    ff

  4. D

    f(μ1)\frac{f}{(\mu - 1)}

Show answer

Correct option: C

Q43JEE Main 2025 Jan 23 Shift 2Dual Nature of Matter and RadiationEasy

In photoelectric effect an em-wave is incident on a metal surface and electrons are ejected from the surface. If the work function of the metal is 2.14 eV and stopping potential is 2V, what is the wavelength of the em-wave ?

(Given hc = 1242 eVnm where h is the Planck's constant and c is the speed of light in vaccum.)

  1. A

    200 nm

  2. B

    300 nm

  3. C

    400 nm

  4. D

    600 nm

Show answer

Correct option: B

Q44JEE Main 2025 Jan 23 Shift 2Atoms and NucleiEasy

Given below are two statements. One is labelled as Assertion (A) and the other is labelled as Reason (R).

Assertion (A) : The binding energy per nucleon is found to be practically independent of the atomic number A, for nuclei with mass numbers between 30 and 170.

Reason (R) : Nuclear force is long range.

In the light of the above statements, choose the correct answer from the options given below :

  1. A

    Both (A) and (R) are true and (R) is the correct explanation of (A)

  2. B

    Both (A) and (R) are true but (R) is NOT the correct explanation of (A)

  3. C

    (A) is true but (R) is false

  4. D

    (A) is false but (R) is true

Show answer

Correct option: C

Q45JEE Main 2025 Jan 23 Shift 2Electronic DevicesMedium

What is the current through the battery in the circuit shown below ?

[Figure: circuit with two parallel branches, each containing a diode in series with a 20 Ω20~\Omega resistor; both diodes are oriented in the same direction; the parallel combination is connected across a 5 V battery]

  1. A

    0.25 A

  2. B

    0.5 A

  3. C

    1.0 A

  4. D

    1.5 A

Show answer

Correct option: B

Q46JEE Main 2025 Jan 23 Shift 2GravitationMediumNumerical

A satellite of mass M2\frac{M}{2} is revolving around the earth in a circular orbit at a height of R3\frac{R}{3} from the surface of the earth. The angular momentum of the satellite is MGMRxM\sqrt{\frac{GMR}{x}}. The value of xx is __________, where M and R are the mass and radius of the earth, respectively.

(G is the gravitational constant)

Show answer

Answer: 3

Q47JEE Main 2025 Jan 23 Shift 2Properties of Solids and LiquidsMediumNumerical

An air bubble of radius 1.0 mm is observed at a depth of 20 cm below the free surface of a liquid having surface tension 0.095 J/m20.095~\mathrm{J/m^2} and density 103 kg/m310^3~\mathrm{kg/m^3}. The difference between pressure inside the bubble and atmospheric pressure is __________ N/m2\mathrm{N/m^2}.

(Take g=10 m/s2g = 10~\mathrm{m/s^2})

Show answer

Answer: 2190

Q48JEE Main 2025 Jan 23 Shift 2Electromagnetic WavesMediumNumerical

A time varying potential difference is applied between the plates of a parallel plate capacitor of capacitance 2.5 μF2.5~\mu\mathrm{F}. The dielectric constant of the medium between the capacitor plates is 1. It produces an instantaneous displacement current of 0.25 mA in the intervening space between the capacitor plates, the magnitude of the rate of change of the potential difference will be __________ Vs1\mathrm{Vs^{-1}}.

Show answer

Answer: 100

Q49JEE Main 2025 Jan 23 Shift 2Electromagnetic Induction and Alternating CurrentsEasyNumerical

In a series LCR circuit, a resistor of 300 Ω300~\Omega, a capacitor of 25 nF and an inductor of 100 mH are used. For maximum current in the circuit, the angular frequency of the ac source is __________ ×104\times 10^4 radians s1\mathrm{s^{-1}}.

Show answer

Answer: 2

Q50JEE Main 2025 Jan 23 Shift 2Current ElectricityMediumNumerical

At steady state the charge on the capacitor, as shown in the circuit below, is __________ μC\mu\mathrm{C}.

[Figure: circuit with an 8 μF8~\mu\mathrm{F} capacitor connected in parallel with a 10 Ω10~\Omega resistor; this combination is in series with a 15 Ω15~\Omega resistor and a 5 V battery]

Show answer

Answer: 16

Chemistry

Q51JEE Main 2025 Jan 23 Shift 2Atomic StructureMedium

Given below are two statements :

Statement (I) : For a given shell, the total number of allowed orbitals is given by n2n^2.

Statement (II) : For any subshell, the spatial orientation of the orbitals is given by l-l to +l+l values including zero.

In the light of the above statements, choose the correct answer from the options given below :

  1. A

    Both Statement I and Statement II are true

  2. B

    Both Statement I and Statement II are false

  3. C

    Statement I is true but Statement II is false

  4. D

    Statement I is false but Statement II is true

Show answer

Correct option: A

Q52JEE Main 2025 Jan 23 Shift 2Chemical ThermodynamicsMedium

The effect of temperature on spontaneity of reactions are represented as :

ΔH\Delta H ΔS\Delta S Temperature Spontaneity
(A) ++ - any T Non spontaneous
(B) ++ ++ low T spontaneous
(C) - - low T Non spontaneous
(D) - ++ any T spontaneous

The incorrect combinations are :

  1. A

    (B) and (D) only

  2. B

    (A) and (C) only

  3. C

    (B) and (C) only

  4. D

    (A) and (D) only

Show answer

Correct option: C

Q53JEE Main 2025 Jan 23 Shift 2Redox Reactions and ElectrochemistryMedium

Standard electrode potentials for a few half cells are mentioned below :

ECu2+/Cu=0.34 V,EZn2+/Zn=0.76 VE^{\circ}_{Cu^{2+}/Cu} = 0.34\ \mathrm{V},\quad E^{\circ}_{Zn^{2+}/Zn} = -0.76\ \mathrm{V}

EAg+/Ag=0.80 V,EMg2+/Mg=2.37 VE^{\circ}_{Ag^{+}/Ag} = 0.80\ \mathrm{V},\quad E^{\circ}_{Mg^{2+}/Mg} = -2.37\ \mathrm{V}

Which one of the following cells gives the most negative value of ΔG\Delta G^{\circ} ?

  1. A

    AgAg+ (1M)Mg2+ (1M)Mg\mathrm{Ag\,|\,Ag^{+}\ (1M)\,||\,Mg^{2+}\ (1M)\,|\,Mg}

  2. B

    ZnZn2+ (1M)Mg2+ (1M)Mg\mathrm{Zn\,|\,Zn^{2+}\ (1M)\,||\,Mg^{2+}\ (1M)\,|\,Mg}

  3. C

    CuCu2+ (1M)Ag+ (1M)Ag\mathrm{Cu\,|\,Cu^{2+}\ (1M)\,||\,Ag^{+}\ (1M)\,|\,Ag}

  4. D

    ZnZn2+ (1M)Ag+ (1M)Ag\mathrm{Zn\,|\,Zn^{2+}\ (1M)\,||\,Ag^{+}\ (1M)\,|\,Ag}

Show answer

Correct option: D

Q54JEE Main 2025 Jan 23 Shift 2SolutionsMedium

When a non-volatile solute is added to the solvent, the vapour pressure of the solvent decreases by 10 mm of Hg. The mole fraction of the solute in the solution is 0.2. What would be the mole fraction of the solvent if decrease in vapour pressure is 20 mm of Hg ?

  1. A

    0.8

  2. B

    0.6

  3. C

    0.4

  4. D

    0.2

Show answer

Correct option: B

Q55JEE Main 2025 Jan 23 Shift 2SolutionsHard

Consider a binary solution of two volatile liquid components 1 and 2. x1x_1 and y1y_1 are the mole fractions of component 1 in liquid and vapour phase, respectively. The slope and intercept of the linear plot of 1x1\dfrac{1}{x_1} vs 1y1\dfrac{1}{y_1} are given respectively as :

  1. A

    P10P20, P10P20P20\dfrac{P_1^{0}}{P_2^{0}},\ \dfrac{P_1^{0}-P_2^{0}}{P_2^{0}}

  2. B

    P10P20, P20P10P20\dfrac{P_1^{0}}{P_2^{0}},\ \dfrac{P_2^{0}-P_1^{0}}{P_2^{0}}

  3. C

    P20P10, P10P20P20\dfrac{P_2^{0}}{P_1^{0}},\ \dfrac{P_1^{0}-P_2^{0}}{P_2^{0}}

  4. D

    P20P10, P20P10P20\dfrac{P_2^{0}}{P_1^{0}},\ \dfrac{P_2^{0}-P_1^{0}}{P_2^{0}}

Show answer

Correct option: B

Q56JEE Main 2025 Jan 23 Shift 2EquilibriumHard

Consider the reaction

X2Y(g)X2(g)+12Y2(g)X_2Y(g) \rightleftharpoons X_2(g) + \tfrac{1}{2}Y_2(g)

The equation representing correct relationship between the degree of dissociation (x)(x) of X2Y(g)X_2Y(g) with its equilibrium constant KpK_p is ________.

Assume xx to be very very small.

  1. A

    x=Kpp3x = \sqrt[3]{\dfrac{K_p}{p}}

  2. B

    x=2Kp2p3x = \sqrt[3]{\dfrac{2K_p^{2}}{p}}

  3. C

    x=Kp2p3x = \sqrt[3]{\dfrac{K_p}{2p}}

  4. D

    x=2Kpp3x = \sqrt[3]{\dfrac{2\,K_p}{p}}

Show answer

Correct option: B

Q57JEE Main 2025 Jan 23 Shift 2Chemical KineticsMedium

Which of the following graphs most appropriately represents a zero order reaction ?

  1. A

    [Figure: plot of Rate (y-axis) vs Time (x-axis) showing a straight line decreasing with time]

  2. B

    [Figure: plot of Reactant Concentration (y-axis) vs Time (x-axis) showing a horizontal straight line (constant)]

  3. C

    [Figure: plot of Rate (y-axis) vs Time (x-axis) showing an exponentially decreasing curve]

  4. D

    [Figure: plot of Reactant Concentration (y-axis) vs Time (x-axis) showing a straight line decreasing with time]

Show answer

Correct option: D

Q58JEE Main 2025 Jan 23 Shift 2EquilibriumMedium

pH of water is 7 at 25C25^{\circ}\mathrm{C}. If water is heated to 80C80^{\circ}\mathrm{C}, it's pH will :

  1. A

    Increase

  2. B

    Decrease

  3. C

    Remains the same

  4. D

    H+\mathrm{H^{+}} concentration increases, OH\mathrm{OH^{-}} concentration decreases

Show answer

Correct option: B

Q59JEE Main 2025 Jan 23 Shift 2Classification of Elements and PeriodicityMedium

Given below are two statements about X-ray spectra of elements :

Statement (I) : A plot of ν\sqrt{\nu} (ν=\nu = frequency of X-rays emitted) vs atomic mass is a straight line.

Statement (II) : ν\nu (ν=\nu = frequency of X-rays emitted) vs atomic number is a straight line.

In the light of the above statements, choose the correct answer from the options given below :

  1. A

    Both Statement I and Statement II are true

  2. B

    Both Statement I and Statement II are false

  3. C

    Statement I is true but Statement II is false

  4. D

    Statement I is false but Statement II is true

Show answer

Correct option: B

Q60JEE Main 2025 Jan 23 Shift 2p-Block ElementsMedium

Below are given the atomic numbers of a few elements of group 14. The atomic number of the element with the lowest melting point is :

  1. A

    14

  2. B

    6

  3. C

    82

  4. D

    50

Show answer

Correct option: D

Q61JEE Main 2025 Jan 23 Shift 2d- and f-Block ElementsMedium

Consider the following reactions

K2Cr2O7H2OKOH[A]H2OH2SO4[B]+K2SO4\mathrm{K_2Cr_2O_7} \xrightarrow[-H_2O]{\text{KOH}} [A] \xrightarrow[-H_2O]{\text{H}_2\text{SO}_4} [B] + \mathrm{K_2SO_4}

The products [A] and [B], respectively are :

  1. A

    K2CrO4\mathrm{K_2CrO_4} and Cr2O3\mathrm{Cr_2O_3}

  2. B

    K2CrO4\mathrm{K_2CrO_4} and CrO\mathrm{CrO}

  3. C

    K2CrO4\mathrm{K_2CrO_4} and K2Cr2O7\mathrm{K_2Cr_2O_7}

  4. D

    K2Cr(OH)6\mathrm{K_2Cr(OH)_6} and Cr2O3\mathrm{Cr_2O_3}

Show answer

Correct option: C

Q62JEE Main 2025 Jan 23 Shift 2d- and f-Block ElementsMedium

Match List-I with List-II.

List-I List-II
(A) Bronze (I) Cu, Ni
(B) Brass (II) Fe, Cr, Ni, C
(C) UK silver coin (III) Cu, Zn
(D) Stainless steel (IV) Cu, Sn

Choose the correct answer from the options given below :

  1. A

    (A)-(III), (B)-(IV), (C)-(II), (D)-(I)

  2. B

    (A)-(IV), (B)-(III), (C)-(I), (D)-(II)

  3. C

    (A)-(III), (B)-(I), (C)-(IV), (D)-(II)

  4. D

    (A)-(IV), (B)-(II), (C)-(III), (D)-(I)

Show answer

Correct option: B

Q63JEE Main 2025 Jan 23 Shift 2Coordination CompoundsHard

Identify the coordination complexes in which the central metal ion has d4d^4 configuration.

(A) [FeO4]2\mathrm{[FeO_4]^{2-}}

(B) [Mn(CN)6]3\mathrm{[Mn(CN)_6]^{3-}}

(C) [Fe(CN)6]3\mathrm{[Fe(CN)_6]^{3-}}

(D) Cr2(OCOMe)4(H2O)2\mathrm{Cr_2(O{-}\overset{\overset{\textstyle O}{\|}}{C}{-}Me)_4(H_2O)_2} (chromium(II) acetate dimer)

(E) [NiF6]2\mathrm{[NiF_6]^{2-}}

Choose the correct answer from the options given below :

  1. A

    (B) and (D) only

  2. B

    (A), (B) and (E) only

  3. C

    (C) and (E) only

  4. D

    (B), (C) and (D) only

Show answer

Correct option: A

Q64JEE Main 2025 Jan 23 Shift 2Principles Related to Practical ChemistryMedium

Identify A, B and C in the given below reaction sequence

[A]HNO3Pb(NO3)2H2SO4[B](2) Acetic acid(3) K2CrO4(1) Ammonium acetate[C] (Yellow ppt)[A] \xrightarrow{\text{HNO}_3} \mathrm{Pb(NO_3)_2} \xrightarrow{\text{H}_2\text{SO}_4} [B] \xrightarrow[\substack{(2)\ \text{Acetic acid}\\ (3)\ \mathrm{K_2CrO_4}}]{(1)\ \text{Ammonium acetate}} [C]\ (\text{Yellow ppt})

  1. A

    PbCl2, PbSO4, PbCrO4\mathrm{PbCl_2},\ \mathrm{PbSO_4},\ \mathrm{PbCrO_4}

  2. B

    PbCl2, Pb(SO4)2, PbCrO4\mathrm{PbCl_2},\ \mathrm{Pb(SO_4)_2},\ \mathrm{PbCrO_4}

  3. C

    PbS, PbSO4, Pb(CH3COO)2\mathrm{PbS},\ \mathrm{PbSO_4},\ \mathrm{Pb(CH_3COO)_2}

  4. D

    PbS, PbSO4, PbCrO4\mathrm{PbS},\ \mathrm{PbSO_4},\ \mathrm{PbCrO_4}

Show answer

Correct option: D

Q65JEE Main 2025 Jan 23 Shift 2Organic Compounds Containing OxygenMedium

Consider the following reaction

RCOR+H2OKRCOHOHR\mathrm{R{-}\overset{\overset{\textstyle O}{\|}}{C}{-}R} + H_2O \underset{}{\overset{K}{\rightleftharpoons}} \mathrm{R{-}\underset{\underset{\textstyle OH}{|}}{\overset{\overset{\textstyle OH}{|}}{C}}{-}R}

Statement (I) : In the case of formaldehyde (HCOH\mathrm{H{-}\overset{\overset{\textstyle O}{\|}}{C}{-}H}), K is about 2280, due to small substituents, hydration is faster.

Statement (II) : In the case of trichloro acetaldehyde (HCOCCl3\mathrm{H{-}\overset{\overset{\textstyle O}{\|}}{C}{-}CCl_3}), K is about 2000 due to I-I effect of Cl-Cl.

In the light of the above statements, choose the correct answer from the options given below :

  1. A

    Both Statement I and Statement II are true

  2. B

    Both Statement I and Statement II are false

  3. C

    Statement I is true but Statement II is false

  4. D

    Statement I is false but Statement II is true

Show answer

Correct option: A

Q66JEE Main 2025 Jan 23 Shift 2HydrocarbonsHard

Match List-I (Isomers of C10H14\mathrm{C_{10}H_{14}}) with List-II (Ozonolysis product).

[Figure: List-I shows four bicyclic hydrocarbon structures (methyl-substituted hydrindane/indane-type fused 6- and 5-membered rings, each with one ring double bond) labelled (A), (B), (C), (D); List-II shows four open-chain poly-carbonyl ozonolysis products labelled (I)-(IV).]

  • (A) 2-methyl bicyclic isomer with double bond in the six-membered ring
  • (B) 2-methyl isomer with double bond at the ring fusion / five-membered ring
  • (C) 6-methyl isomer with double bond in the six-membered ring
  • (D) 1-methyl isomer with the double bond conjugated to the ring junction

List-II products:

  • (I) HCOCH(CH3)CH2CO(CH2)3COCHO\mathrm{H{-}CO{-}CH(CH_3){-}CH_2{-}CO{-}(CH_2)_3{-}CO{-}CHO} type dialdehyde/diketone with a branch methyl
  • (II) CH3COCO(CH2)4COCHO\mathrm{CH_3{-}CO{-}CO{-}(CH_2)_4{-}CO{-}CHO} type
  • (III) HCOCH2CH2COCH(CH3)COCHO\mathrm{H{-}CO{-}CH_2CH_2{-}CO{-}CH(CH_3){-}CO{-}CHO} type (two terminal CHO, a mid ketone and a branch methyl)
  • (IV) HCOCO(CH2)4COCOCH3\mathrm{H{-}CO{-}CO{-}(CH_2)_4{-}CO{-}CO{-}CH_3} type

Choose the correct answer from the options given below :

  1. A

    (A)-(III), (B)-(II), (C)-(I), (D)-(IV)

  2. B

    (A)-(II), (B)-(III), (C)-(I), (D)-(IV)

  3. C

    (A)-(I), (B)-(IV), (C)-(III), (D)-(II)

  4. D

    (A)-(III), (B)-(IV), (C)-(I), (D)-(II)

Show answer

Correct option: D

Q67JEE Main 2025 Jan 23 Shift 2Organic Compounds Containing HalogensHard

The ascending order of relative rate of solvolysis of following compounds is :

[Figure: four bromo compounds]

  • (A) 1-bromo-3,3,5,5-tetramethylcyclohexane (tertiary bromide on a gem-dimethyl-substituted cyclohexane ring)
  • (B) 1-bromo-1,2,3,4-tetrahydronaphthalene (benzylic secondary bromide, with a methyl at the 4-position)
  • (C) bromodiphenylmethane, (C6H5)2CHBr\mathrm{(C_6H_5)_2CHBr} (dibenzylic secondary bromide)
  • (D) 3-bromo-2-methylpentane (a secondary alkyl bromide)
  1. A

    (D) < (B) < (A) < (C)

  2. B

    (C) < (B) < (A) < (D)

  3. C

    (C) < (D) < (B) < (A)

  4. D

    (D) < (A) < (B) < (C)

Show answer

Correct option: D

Q68JEE Main 2025 Jan 23 Shift 2Organic Compounds Containing OxygenMedium

Identify the products [A] and [B], respectively in the following reaction :

Chlorobenzene(ii) H+(i) NaOH, 623 K, 300 atm[A]H2SO4Na2Cr2O7[B]\text{Chlorobenzene} \xrightarrow[\text{(ii) } H^{+}]{\text{(i) NaOH, 623 K, 300 atm}} [A] \xrightarrow[\text{H}_2\text{SO}_4]{\text{Na}_2\text{Cr}_2\text{O}_7} [B]

  1. A

    [A] benzene, [B] phenol

  2. B

    [A] phenol, [B] sodium phenoxide (C6H5ONa+\mathrm{C_6H_5O^{-}Na^{+}})

  3. C

    [A] benzene, [B] cyclohexa-2,4-dien-1-one (an unsaturated cyclic ketone)

  4. D

    [A] phenol, [B] benzoquinone (cyclohexa-2,5-diene-1,4-dione)

Show answer

Correct option: D

Q69JEE Main 2025 Jan 23 Shift 2Organic Compounds Containing OxygenEasy

Given below are two statements :

Statement (I) : The boiling points of alcohols and phenols increase with increase in the number of C-atoms.

Statement (II) : The boiling points of alcohols and phenols are higher in comparison to other class of compounds such as ethers, haloalkanes.

In the light of the above statements, choose the correct answer from the options given below :

  1. A

    Both Statement I and Statement II are true

  2. B

    Both Statement I and Statement II are false

  3. C

    Statement I is true but Statement II is false

  4. D

    Statement I is false but Statement II is true

Show answer

Correct option: A

Q70JEE Main 2025 Jan 23 Shift 2BiomoleculesEasy

The α\alpha-Helix and β\beta-Pleated sheet structures of protein are associated with its :

  1. A

    primary structure

  2. B

    secondary structure

  3. C

    tertiary structure

  4. D

    quaternary structure

Show answer

Correct option: B

Q71JEE Main 2025 Jan 23 Shift 2Some Basic Concepts in ChemistryMediumNumerical

When 81.0 g of aluminium is allowed to react with 128.0 g of oxygen gas, the mass of aluminium oxide produced in grams is ________. (Nearest integer)

Given :

Molar mass of Al is 27.0 g mol127.0\ \mathrm{g\ mol^{-1}}

Molar mass of O is 16.0 g mol116.0\ \mathrm{g\ mol^{-1}}

Show answer

Answer: 153

Q72JEE Main 2025 Jan 23 Shift 2Chemical ThermodynamicsHardNumerical

The bond dissociation enthalpy of X2X_2, ΔHbond\Delta H^{\circ}_{\text{bond}} calculated from the given data is ________ kJ mol1\mathrm{kJ\ mol^{-1}}. (Nearest integer)

M+X(s)M+(g)+X(g)ΔHlattice=800 kJ mol1\mathrm{M^{+}X^{-}(s) \rightarrow M^{+}(g) + X^{-}(g)} \quad \Delta H^{\circ}_{\text{lattice}} = 800\ \mathrm{kJ\ mol^{-1}}

M(s)M(g)ΔHsub=100 kJ mol1\mathrm{M(s) \rightarrow M(g)} \quad \Delta H^{\circ}_{\text{sub}} = 100\ \mathrm{kJ\ mol^{-1}}

M(g)M+(g)+e(g)ΔHi=500 kJ mol1\mathrm{M(g) \rightarrow M^{+}(g) + e^{-}(g)} \quad \Delta H^{\circ}_{i} = 500\ \mathrm{kJ\ mol^{-1}}

X(g)+e(g)X(g)ΔHeg=300 kJ mol1\mathrm{X(g) + e^{-}(g) \rightarrow X^{-}(g)} \quad \Delta H^{\circ}_{\text{eg}} = -300\ \mathrm{kJ\ mol^{-1}}

M(s)+12X2(g)M+X(s)ΔHf=400 kJ mol1\mathrm{M(s) + \tfrac{1}{2}X_2(g) \rightarrow M^{+}X^{-}(s)} \quad \Delta H^{\circ}_{f} = -400\ \mathrm{kJ\ mol^{-1}}

[Given : M+X\mathrm{M^{+}X^{-}} is a pure ionic compound and X forms a diatomic molecule X2X_2 in gaseous state]

Show answer

Answer: 200

Q73JEE Main 2025 Jan 23 Shift 2Purification and Characterisation of Organic CompoundsMediumNumerical

0.01 mole of an organic compound (X) containing 10% hydrogen, on complete combustion produced 0.9 g H2O\mathrm{H_2O}. Molar mass of (X) is ________ g mol1\mathrm{g\ mol^{-1}}.

Show answer

Answer: 100

Q74JEE Main 2025 Jan 23 Shift 2Some Basic Principles of Organic ChemistryHardNumerical

A compound 'X' absorbs 2 moles of hydrogen and 'X' upon oxidation with KMnO4H+\mathrm{KMnO_4\,|\,H^{+}} gives CH3COCH3\mathrm{CH_3{-}\overset{\overset{\textstyle O}{\|}}{C}{-}CH_3}, CH3COOH\mathrm{CH_3{-}\overset{\overset{\textstyle O}{\|}}{C}{-}OH} and CH3COCH2CH2COOH\mathrm{CH_3{-}\overset{\overset{\textstyle O}{\|}}{C}{-}CH_2CH_2{-}\overset{\overset{\textstyle O}{\|}}{C}{-}OH}.

The total number of σ\sigma bonds present in the compound 'X' is ________.

Show answer

Answer: 27

Q75JEE Main 2025 Jan 23 Shift 2Organic Compounds Containing NitrogenHardNumerical

Consider the following sequence of reactions.

[Figure: reaction scheme] 4-ethoxyaniline (p-ethoxyaniline) 0-5C(i) NaNO2, HCl\xrightarrow[\text{0-5}^{\circ}\text{C}]{\text{(i) NaNO}_2,\ \text{HCl}} (A, the diazonium salt) (ii) dil. HCl(i) phenol, NaOH\xrightarrow[\text{(ii) dil. HCl}]{\text{(i) phenol, NaOH}} (B) (Molecular formula C14H14N2O2\mathrm{C_{14}H_{14}N_2O_2}) (ii) H3CCH2Br(i) NaOH\xrightarrow[\text{(ii) } \mathrm{H_3CCH_2Br}]{\text{(i) NaOH}} (C) (Molecular formula C16H18N2O2\mathrm{C_{16}H_{18}N_2O_2})

Total number of sp3sp^3 hybridised carbon atoms in the major product C formed is ________.

Show answer

Answer: 4